C15H22O3Si — CID 134897559
dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-prop-2-enoxysilane (PubChem CID 134897559) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-prop-2-enoxysilane.
| Compound Name | dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-prop-2-enoxysilane |
|---|---|
| PubChem CID | 134897559 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-prop-2-enoxysilane |
| SMILES | C=CCO[Si](C)(C)C#CC#CCOC1CCCCO1 |
| InChI | InChI=1S/C15H22O3Si/c1-4-11-18-19(2,3)14-9-5-7-12-16-15-10-6-8-13-17-15/h4,15H,1,6,8,10-13H2,2-3H3 |
| InChIKey | OGFGNGPTZAJLFH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|