C12H18OS2 — CID 117058943
5-(3,6-dihydro-2H-thiopyran-5-ylmethoxymethyl)-3,6-dihydro-2H-thiopyran (PubChem CID 117058943) has the molecular formula C12H18OS2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-thiopyran-5-ylmethoxymethyl)-3,6-dihydro-2H-thiopyran.
| Compound Name | 5-(3,6-dihydro-2H-thiopyran-5-ylmethoxymethyl)-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 117058943 |
| Molecular Formula | C12H18OS2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-(3,6-dihydro-2H-thiopyran-5-ylmethoxymethyl)-3,6-dihydro-2H-thiopyran |
| SMILES | C1=C(COCC2=CCCSC2)CSCC1 |
| InChI | InChI=1S/C12H18OS2/c1-3-11(9-14-5-1)7-13-8-12-4-2-6-15-10-12/h3-4H,1-2,5-10H2 |
| InChIKey | QKPOBCXNGVQRRY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|