C10H14N2O3S2 — CID 117059597
(2-propylsulfanylphenyl)sulfonylurea (PubChem CID 117059597) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is (2-propylsulfanylphenyl)sulfonylurea.
| Compound Name | (2-propylsulfanylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 117059597 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (2-propylsulfanylphenyl)sulfonylurea |
| SMILES | CCCSc1ccccc1S(=O)(=O)NC(N)=O |
| InChI | InChI=1S/C10H14N2O3S2/c1-2-7-16-8-5-3-4-6-9(8)17(14,15)12-10(11)13/h3-6H,2,7H2,1H3,(H3,11,12,13) |
| InChIKey | TVQKBXSSARTNKT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |