C11H12ClNO3S — CID 117059727
ethyl 2-[(4-chlorophenyl)sulfanylcarbonylamino]acetate (PubChem CID 117059727) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)sulfanylcarbonylamino]acetate.
| Compound Name | ethyl 2-[(4-chlorophenyl)sulfanylcarbonylamino]acetate |
|---|---|
| PubChem CID | 117059727 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)sulfanylcarbonylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-2-16-10(14)7-13-11(15)17-9-5-3-8(12)4-6-9/h3-6H,2,7H2,1H3,(H,13,15) |
| InChIKey | UTPUCAXTYFLWHA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|