C6H12N2O6S2 — CID 117060563
1,4-bis(methylsulfonyl)-2,3-dinitrosobutane (PubChem CID 117060563) has the molecular formula C6H12N2O6S2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1,4-bis(methylsulfonyl)-2,3-dinitrosobutane.
| Compound Name | 1,4-bis(methylsulfonyl)-2,3-dinitrosobutane |
|---|---|
| PubChem CID | 117060563 |
| Molecular Formula | C6H12N2O6S2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1,4-bis(methylsulfonyl)-2,3-dinitrosobutane |
| SMILES | CS(=O)(=O)CC(N=O)C(CS(C)(=O)=O)N=O |
| InChI | InChI=1S/C6H12N2O6S2/c1-15(11,12)3-5(7-9)6(8-10)4-16(2,13)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | QXOMBMYMYLTXEL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 127.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |