About 3-nitrosooctane
3-nitrosooctane (PubChem CID 57157162) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-nitrosooctane.
Molecular Properties
| Compound Name | 3-nitrosooctane |
| PubChem CID | 57157162 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 3-nitrosooctane |
| SMILES | CCCCCC(CC)N=O |
| InChI | InChI=1S/C8H17NO/c1-3-5-6-7-8(4-2)9-10/h8H,3-7H2,1-2H3 |
| InChIKey | GTAMZWKWRLPZDB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrosooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosooctane?
The IUPAC name of 3-nitrosooctane (CID 57157162) is 3-nitrosooctane.
What is the SMILES notation for 3-nitrosooctane?
The canonical SMILES for 3-nitrosooctane is CCCCCC(CC)N=O.
What is the InChIKey of 3-nitrosooctane?
The InChIKey is GTAMZWKWRLPZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-5-6-7-8(4-2)9-10/h8H,3-7H2,1-2H3.
What are the key properties of 3-nitrosooctane?
3-nitrosooctane has a molecular weight of 143.23 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosooctane is sourced from PubChem (CID 57157162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).