About 4-nitrosooctadecane
4-nitrosooctadecane (PubChem CID 122423399) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is 4-nitrosooctadecane.
Molecular Properties
| Compound Name | 4-nitrosooctadecane |
| PubChem CID | 122423399 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 4-nitrosooctadecane |
| SMILES | CCCCCCCCCCCCCCC(CCC)N=O |
| InChI | InChI=1S/C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(19-20)16-4-2/h18H,3-17H2,1-2H3 |
| InChIKey | QNTXXFMXOJGXPR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrosooctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrosooctadecane?
The IUPAC name of 4-nitrosooctadecane (CID 122423399) is 4-nitrosooctadecane.
What is the SMILES notation for 4-nitrosooctadecane?
The canonical SMILES for 4-nitrosooctadecane is CCCCCCCCCCCCCCC(CCC)N=O.
What is the InChIKey of 4-nitrosooctadecane?
The InChIKey is QNTXXFMXOJGXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(19-20)16-4-2/h18H,3-17H2,1-2H3.
What are the key properties of 4-nitrosooctadecane?
4-nitrosooctadecane has a molecular weight of 283.50 g/mol, XLogP of 7.01, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrosooctadecane is sourced from PubChem (CID 122423399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).