About 5-nitrosooctadecan-2-ol
5-nitrosooctadecan-2-ol (PubChem CID 87834682) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 5-nitrosooctadecan-2-ol.
Molecular Properties
| Compound Name | 5-nitrosooctadecan-2-ol |
| PubChem CID | 87834682 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 5-nitrosooctadecan-2-ol |
| SMILES | CCCCCCCCCCCCCC(CCC(C)O)N=O |
| InChI | InChI=1S/C18H37NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(19-21)16-15-17(2)20/h17-18,20H,3-16H2,1-2H3 |
| InChIKey | WHNDBEBUBXPEGB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrosooctadecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrosooctadecan-2-ol?
The IUPAC name of 5-nitrosooctadecan-2-ol (CID 87834682) is 5-nitrosooctadecan-2-ol.
What is the SMILES notation for 5-nitrosooctadecan-2-ol?
The canonical SMILES for 5-nitrosooctadecan-2-ol is CCCCCCCCCCCCCC(CCC(C)O)N=O.
What is the InChIKey of 5-nitrosooctadecan-2-ol?
The InChIKey is WHNDBEBUBXPEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(19-21)16-15-17(2)20/h17-18,20H,3-16H2,1-2H3.
What are the key properties of 5-nitrosooctadecan-2-ol?
5-nitrosooctadecan-2-ol has a molecular weight of 299.50 g/mol, XLogP of 5.98, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrosooctadecan-2-ol is sourced from PubChem (CID 87834682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).