About 9-(nitrosomethyl)icosane
9-(nitrosomethyl)icosane (PubChem CID 122613192) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is 9-(nitrosomethyl)icosane.
Molecular Properties
| Compound Name | 9-(nitrosomethyl)icosane |
| PubChem CID | 122613192 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | 9-(nitrosomethyl)icosane |
| SMILES | CCCCCCCCCCCC(CCCCCCCC)CN=O |
| InChI | InChI=1S/C21H43NO/c1-3-5-7-9-11-12-13-15-17-19-21(20-22-23)18-16-14-10-8-6-4-2/h21H,3-20H2,1-2H3 |
| InChIKey | WUAHABRMVICIHM-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(nitrosomethyl)icosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(nitrosomethyl)icosane?
The IUPAC name of 9-(nitrosomethyl)icosane (CID 122613192) is 9-(nitrosomethyl)icosane.
What is the SMILES notation for 9-(nitrosomethyl)icosane?
The canonical SMILES for 9-(nitrosomethyl)icosane is CCCCCCCCCCCC(CCCCCCCC)CN=O.
What is the InChIKey of 9-(nitrosomethyl)icosane?
The InChIKey is WUAHABRMVICIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO/c1-3-5-7-9-11-12-13-15-17-19-21(20-22-23)18-16-14-10-8-6-4-2/h21H,3-20H2,1-2H3.
What are the key properties of 9-(nitrosomethyl)icosane?
9-(nitrosomethyl)icosane has a molecular weight of 325.58 g/mol, XLogP of 8.04, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(nitrosomethyl)icosane is sourced from PubChem (CID 122613192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).