C14H18O3 — CID 117062487
2-[(Z)-3-(3-methoxyphenyl)prop-2-enyl]-1,3-dioxane (PubChem CID 117062487) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(Z)-3-(3-methoxyphenyl)prop-2-enyl]-1,3-dioxane.
| Compound Name | 2-[(Z)-3-(3-methoxyphenyl)prop-2-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 117062487 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-[(Z)-3-(3-methoxyphenyl)prop-2-enyl]-1,3-dioxane |
| SMILES | COc1cccc(/C=C\CC2OCCCO2)c1 |
| InChI | InChI=1S/C14H18O3/c1-15-13-7-2-5-12(11-13)6-3-8-14-16-9-4-10-17-14/h2-3,5-7,11,14H,4,8-10H2,1H3/b6-3- |
| InChIKey | HCYHADKJAFLBDE-UTCJRWHESA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |