C17H24N2O2 — CID 97221680
(2R)-1-[(E)-4-(3-methoxyphenyl)but-3-enyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 97221680) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R)-1-[(E)-4-(3-methoxyphenyl)but-3-enyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(E)-4-(3-methoxyphenyl)but-3-enyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97221680 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2R)-1-[(E)-4-(3-methoxyphenyl)but-3-enyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CCCN1CC/C=C/c1cccc(OC)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-18-17(20)16-10-6-12-19(16)11-4-3-7-14-8-5-9-15(13-14)21-2/h3,5,7-9,13,16H,4,6,10-12H2,1-2H3,(H,18,20)/b7-3+/t16-/m1/s1 |
| InChIKey | JRIWPSLEGICFMR-LERPRCHQSA-N |
| XLogP | 2.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |