C14H10F2N2O — CID 117062593
3-(2,6-difluorophenyl)-5-phenyl-2,5-dihydro-1,2,4-oxadiazole (PubChem CID 117062593) has the molecular formula C14H10F2N2O and a molecular weight of 260.24 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-5-phenyl-2,5-dihydro-1,2,4-oxadiazole.
| Compound Name | 3-(2,6-difluorophenyl)-5-phenyl-2,5-dihydro-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 117062593 |
| Molecular Formula | C14H10F2N2O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(2,6-difluorophenyl)-5-phenyl-2,5-dihydro-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccccc2)ON1 |
| InChI | InChI=1S/C14H10F2N2O/c15-10-7-4-8-11(16)12(10)13-17-14(19-18-13)9-5-2-1-3-6-9/h1-8,14H,(H,17,18) |
| InChIKey | PSNWRSCRJOFNCL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |