C17H18O — CID 117063352
1,1-bis(4-methylphenyl)prop-2-en-1-ol (PubChem CID 117063352) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,1-bis(4-methylphenyl)prop-2-en-1-ol.
| Compound Name | 1,1-bis(4-methylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 117063352 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1,1-bis(4-methylphenyl)prop-2-en-1-ol |
| SMILES | C=CC(O)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18O/c1-4-17(18,15-9-5-13(2)6-10-15)16-11-7-14(3)8-12-16/h4-12,18H,1H2,2-3H3 |
| InChIKey | QXEVKWLVJMOZFC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|