About 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol
4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol (PubChem CID 117068366) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol |
| PubChem CID | 117068366 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol |
| SMILES | Cc1ccn(CC(O)C(C)(C)CN(C)C)n1 |
| InChI | InChI=1S/C12H23N3O/c1-10-6-7-15(13-10)8-11(16)12(2,3)9-14(4)5/h6-7,11,16H,8-9H2,1-5H3 |
| InChIKey | DWLDAVKVSDOPBS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol?
The IUPAC name of 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol (CID 117068366) is 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol.
What is the SMILES notation for 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol?
The canonical SMILES for 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol is Cc1ccn(CC(O)C(C)(C)CN(C)C)n1.
What is the InChIKey of 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol?
The InChIKey is DWLDAVKVSDOPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-10-6-7-15(13-10)8-11(16)12(2,3)9-14(4)5/h6-7,11,16H,8-9H2,1-5H3.
What are the key properties of 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol?
4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol has a molecular weight of 225.34 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-3,3-dimethyl-1-(3-methylpyrazol-1-yl)butan-2-ol is sourced from PubChem (CID 117068366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).