C12H18O2Si — CID 117070686
6-methyl-2-trimethylsilyl-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 117070686) has the molecular formula C12H18O2Si and a molecular weight of 222.36 g/mol. Its IUPAC name is 6-methyl-2-trimethylsilyl-6,7-dihydro-5H-1-benzofuran-4-one.
| Compound Name | 6-methyl-2-trimethylsilyl-6,7-dihydro-5H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 117070686 |
| Molecular Formula | C12H18O2Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-methyl-2-trimethylsilyl-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | CC1CC(=O)c2cc([Si](C)(C)C)oc2C1 |
| InChI | InChI=1S/C12H18O2Si/c1-8-5-10(13)9-7-12(15(2,3)4)14-11(9)6-8/h7-8H,5-6H2,1-4H3 |
| InChIKey | YXGRYCNLTBDNHX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|