C19H24O3 — CID 117070835
(3R)-1-ethenyl-3-hydroxy-3-[(4-methoxyphenyl)methyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 117070835) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R)-1-ethenyl-3-hydroxy-3-[(4-methoxyphenyl)methyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (3R)-1-ethenyl-3-hydroxy-3-[(4-methoxyphenyl)methyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 117070835 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3R)-1-ethenyl-3-hydroxy-3-[(4-methoxyphenyl)methyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C=CC12CCC(C1(C)C)[C@](O)(Cc1ccc(OC)cc1)C2=O |
| InChI | InChI=1S/C19H24O3/c1-5-18-11-10-15(17(18,2)3)19(21,16(18)20)12-13-6-8-14(22-4)9-7-13/h5-9,15,21H,1,10-12H2,2-4H3/t15?,18?,19-/m1/s1 |
| InChIKey | ZNNVPGNNEGFWMO-XUJQIHCRSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|