C25H30ClN4O4+ — CID 117072208
(3R)-1-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-chloro-4-hydroxyphenyl)pyrrolidin-1-ium-3-carboxamide (PubChem CID 117072208) has the molecular formula C25H30ClN4O4+ and a molecular weight of 485.99 g/mol. Its IUPAC name is (3R)-1-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-chloro-4-hydroxyphenyl)pyrrolidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-chloro-4-hydroxyphenyl)pyrrolidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 117072208 |
| Molecular Formula | C25H30ClN4O4+ |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (3R)-1-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-chloro-4-hydroxyphenyl)pyrrolidin-1-ium-3-carboxamide |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)C[NH+]3CC[C@@H](C(=O)Nc4ccc(O)c(Cl)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H29ClN4O4/c1-17(31)18-2-5-21(6-3-18)29-10-12-30(13-11-29)24(33)16-28-9-8-19(15-28)25(34)27-20-4-7-23(32)22(26)14-20/h2-7,14,19,32H,8-13,15-16H2,1H3,(H,27,34)/p+1/t19-/m1/s1 |
| InChIKey | YPNCCYRKEHPJMN-LJQANCHMSA-O |
| XLogP | 1.44 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|