C26H27N5O — CID 117073054
2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-phenylphenyl)ethanone (PubChem CID 117073054) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-phenylphenyl)ethanone.
| Compound Name | 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 117073054 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-phenylphenyl)ethanone |
| SMILES | NC(C(=O)N1CCC(Nc2ccc3[nH]ncc3c2)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N5O/c27-25(20-8-6-19(7-9-20)18-4-2-1-3-5-18)26(32)31-14-12-22(13-15-31)29-23-10-11-24-21(16-23)17-28-30-24/h1-11,16-17,22,25,29H,12-15,27H2,(H,28,30) |
| InChIKey | YJTQUZJHTPEBPE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |