C21H25N5O — CID 117073159
2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-methylphenyl)ethanone (PubChem CID 117073159) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-methylphenyl)ethanone.
| Compound Name | 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 117073159 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-amino-1-[4-(1H-indazol-5-ylamino)piperidin-1-yl]-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(N)C(=O)N2CCC(Nc3ccc4[nH]ncc4c3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O/c1-14-2-4-15(5-3-14)20(22)21(27)26-10-8-17(9-11-26)24-18-6-7-19-16(12-18)13-23-25-19/h2-7,12-13,17,20,24H,8-11,22H2,1H3,(H,23,25) |
| InChIKey | IZITXYPZZPHCJS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |