C23H25F3N6O5 — CID 117074437
tert-butyl N-[(1S)-2-oxo-1-phenyl-2-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methylamino]ethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 117074437) has the molecular formula C23H25F3N6O5 and a molecular weight of 522.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-oxo-1-phenyl-2-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methylamino]ethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl N-[(1S)-2-oxo-1-phenyl-2-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methylamino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117074437 |
| Molecular Formula | C23H25F3N6O5 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | tert-butyl N-[(1S)-2-oxo-1-phenyl-2-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methylamino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NCc1nc(-c2ccncc2)n[nH]1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N6O3.C2HF3O2/c1-21(2,3)30-20(29)25-17(14-7-5-4-6-8-14)19(28)23-13-16-24-18(27-26-16)15-9-11-22-12-10-15;3-2(4,5)1(6)7/h4-12,17H,13H2,1-3H3,(H,23,28)(H,25,29)(H,24,26,27);(H,6,7)/t17-;/m0./s1 |
| InChIKey | LLVGOXZYOSGQRX-LMOVPXPDSA-N |
| XLogP | 3.38 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |