C25H27F6N5O3 — CID 175943383
tert-butyl N-[[3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]methyl]carbamate;ethyl 4-(trifluoromethyl)benzenecarboximidate (PubChem CID 175943383) has the molecular formula C25H27F6N5O3 and a molecular weight of 559.51 g/mol. Its IUPAC name is tert-butyl N-[[3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]methyl]carbamate;ethyl 4-(trifluoromethyl)benzenecarboximidate.
| Compound Name | tert-butyl N-[[3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]methyl]carbamate;ethyl 4-(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 175943383 |
| Molecular Formula | C25H27F6N5O3 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | tert-butyl N-[[3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]methyl]carbamate;ethyl 4-(trifluoromethyl)benzenecarboximidate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(-c2ccc(C(F)(F)F)cc2)n[nH]1.[H]/N=C(\OCC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F3N4O2.C10H10F3NO/c1-14(2,3)24-13(23)19-8-11-20-12(22-21-11)9-4-6-10(7-5-9)15(16,17)18;1-2-15-9(14)7-3-5-8(6-4-7)10(11,12)13/h4-7H,8H2,1-3H3,(H,19,23)(H,20,21,22);3-6,14H,2H2,1H3/b;14-9- |
| InChIKey | HMZPQBBRQOEUKE-FUFZTOQCSA-N |
| XLogP | 6.58 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|