C21H22ClN3O3 — CID 117074939
N-[3-chloro-2-(4-prop-2-enylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 117074939) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is N-[3-chloro-2-(4-prop-2-enylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-chloro-2-(4-prop-2-enylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 117074939 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[3-chloro-2-(4-prop-2-enylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CCN1CCN(c2c(Cl)cccc2NC(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H22ClN3O3/c1-2-8-24-9-11-25(12-10-24)20-16(22)4-3-5-17(20)23-21(26)15-6-7-18-19(13-15)28-14-27-18/h2-7,13H,1,8-12,14H2,(H,23,26) |
| InChIKey | TVYMKPQRBAOLAT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|