C24H23F3N4O4 — CID 117077736
N-[2-(3-methoxyphenyl)ethyl]-1-methyl-6-(1H-pyrazol-4-yl)indole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 117077736) has the molecular formula C24H23F3N4O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]-1-methyl-6-(1H-pyrazol-4-yl)indole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]-1-methyl-6-(1H-pyrazol-4-yl)indole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117077736 |
| Molecular Formula | C24H23F3N4O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]-1-methyl-6-(1H-pyrazol-4-yl)indole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(CCNC(=O)c2cn(C)c3cc(-c4cn[nH]c4)ccc23)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H22N4O2.C2HF3O2/c1-26-14-20(19-7-6-16(11-21(19)26)17-12-24-25-13-17)22(27)23-9-8-15-4-3-5-18(10-15)28-2;3-2(4,5)1(6)7/h3-7,10-14H,8-9H2,1-2H3,(H,23,27)(H,24,25);(H,6,7) |
| InChIKey | UFXWTKUUIZQVMZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|