C27H28N6O2 — CID 117078785
N-[1-methyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]pyrazol-5-yl]-2-phenylacetamide (PubChem CID 117078785) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[1-methyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]pyrazol-5-yl]-2-phenylacetamide.
| Compound Name | N-[1-methyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]pyrazol-5-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 117078785 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[1-methyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]pyrazol-5-yl]-2-phenylacetamide |
| SMILES | Cn1nc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)cc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H28N6O2/c1-32-26(30-27(34)17-20-5-3-2-4-6-20)19-24(31-32)21-11-12-28-25(18-21)29-22-7-9-23(10-8-22)33-13-15-35-16-14-33/h2-12,18-19H,13-17H2,1H3,(H,28,29)(H,30,34) |
| InChIKey | RPCUTJROGCGTJG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|