C26H30N6O — CID 1170793
3-[[benzyl-[(1-cyclohexyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 1170793) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is 3-[[benzyl-[(1-cyclohexyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[[benzyl-[(1-cyclohexyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1170793 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-[[benzyl-[(1-cyclohexyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CN(Cc3ccccc3)Cc3nnnn3C3CCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H30N6O/c1-19-12-13-21-15-22(26(33)27-24(21)14-19)17-31(16-20-8-4-2-5-9-20)18-25-28-29-30-32(25)23-10-6-3-7-11-23/h2,4-5,8-9,12-15,23H,3,6-7,10-11,16-18H2,1H3,(H,27,33) |
| InChIKey | OKOINMRCKWSKCS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |