C27H26N6O — CID 1170825
3-[[benzyl-[(1-benzyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 1170825) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-[[benzyl-[(1-benzyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[[benzyl-[(1-benzyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1170825 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-[[benzyl-[(1-benzyltetrazol-5-yl)methyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CN(Cc3ccccc3)Cc3nnnn3Cc3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C27H26N6O/c1-20-12-13-23-15-24(27(34)28-25(23)14-20)18-32(16-21-8-4-2-5-9-21)19-26-29-30-31-33(26)17-22-10-6-3-7-11-22/h2-15H,16-19H2,1H3,(H,28,34) |
| InChIKey | FFTKGDYPVRXYPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |