C9H17NO — CID 11708092
(2S,4R,5S)-2-methyl-5-prop-1-en-2-ylpiperidin-4-ol (PubChem CID 11708092) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (2S,4R,5S)-2-methyl-5-prop-1-en-2-ylpiperidin-4-ol.
| Compound Name | (2S,4R,5S)-2-methyl-5-prop-1-en-2-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 11708092 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2S,4R,5S)-2-methyl-5-prop-1-en-2-ylpiperidin-4-ol |
| SMILES | C=C(C)[C@H]1CN[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C9H17NO/c1-6(2)8-5-10-7(3)4-9(8)11/h7-11H,1,4-5H2,2-3H3/t7-,8+,9+/m0/s1 |
| InChIKey | GMQNYUJMVQHEBT-DJLDLDEBSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|