C8H17NO — CID 57176858
2,3,6-trimethylpiperidin-4-ol (PubChem CID 57176858) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2,3,6-trimethylpiperidin-4-ol.
| Compound Name | 2,3,6-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 57176858 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2,3,6-trimethylpiperidin-4-ol |
| SMILES | CC1CC(O)C(C)C(C)N1 |
| InChI | InChI=1S/C8H17NO/c1-5-4-8(10)6(2)7(3)9-5/h5-10H,4H2,1-3H3 |
| InChIKey | FFRRRWKXLRWRKC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |