C7H16ClNO — CID 56924249
2,2-dimethylpiperidin-4-ol;hydrochloride (PubChem CID 56924249) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is 2,2-dimethylpiperidin-4-ol;hydrochloride.
| Compound Name | 2,2-dimethylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 56924249 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2,2-dimethylpiperidin-4-ol;hydrochloride |
| SMILES | CC1(C)CC(O)CCN1.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-7(2)5-6(9)3-4-8-7;/h6,8-9H,3-5H2,1-2H3;1H |
| InChIKey | HOJRBOZPWDRTAK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |