About 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine
5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 117081858) has the molecular formula C15H17F3N4
and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| PubChem CID | 117081858 |
| Molecular Formula | C15H17F3N4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2ccc(C(F)(F)F)cc2)ncc1C |
| InChI | InChI=1S/C15H17F3N4/c1-3-8-19-13-10(2)9-20-14(22-13)21-12-6-4-11(5-7-12)15(16,17)18/h4-7,9H,3,8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | DVBRUGZDYOZIEL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (CID 117081858) is 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine is CCCNc1nc(Nc2ccc(C(F)(F)F)cc2)ncc1C.
What is the InChIKey of 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The InChIKey is DVBRUGZDYOZIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N4/c1-3-8-19-13-10(2)9-20-14(22-13)21-12-6-4-11(5-7-12)15(16,17)18/h4-7,9H,3,8H2,1-2H3,(H2,19,20,21,22).
What are the key properties of 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine has a molecular weight of 310.32 g/mol, XLogP of 4.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-N-propyl-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 117081858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).