C33H34N8O2 — CID 117082923
N-(4-morpholin-4-ylphenyl)-2-[1-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]indol-3-yl]acetamide (PubChem CID 117082923) has the molecular formula C33H34N8O2 and a molecular weight of 574.69 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-[1-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]indol-3-yl]acetamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-[1-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 117082923 |
| Molecular Formula | C33H34N8O2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-[1-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]indol-3-yl]acetamide |
| SMILES | O=C(Cc1cn(-c2ccc(N3CCN(c4ccccn4)CC3)nn2)c2ccccc12)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C33H34N8O2/c42-33(35-26-8-10-27(11-9-26)38-19-21-43-22-20-38)23-25-24-41(29-6-2-1-5-28(25)29)32-13-12-31(36-37-32)40-17-15-39(16-18-40)30-7-3-4-14-34-30/h1-14,24H,15-23H2,(H,35,42) |
| InChIKey | WSUGDJWCMHXSQT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|