C20H18N2O3S — CID 117087857
5-(4-carbamoylphenyl)-N-[2-(4-hydroxyphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 117087857) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 5-(4-carbamoylphenyl)-N-[2-(4-hydroxyphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-(4-carbamoylphenyl)-N-[2-(4-hydroxyphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 117087857 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-(4-carbamoylphenyl)-N-[2-(4-hydroxyphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2ccc(C(=O)NCCc3ccc(O)cc3)s2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c21-19(24)15-5-3-14(4-6-15)17-9-10-18(26-17)20(25)22-12-11-13-1-7-16(23)8-2-13/h1-10,23H,11-12H2,(H2,21,24)(H,22,25) |
| InChIKey | IHOPZNYTEAABLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |