C15H19N3S — CID 11708855
N-cyclopentyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 11708855) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-cyclopentyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-cyclopentyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 11708855 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-cyclopentyl-5-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(NC1CCCC1)N1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C15H19N3S/c19-15(16-13-8-4-5-9-13)18-11-10-14(17-18)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,16,19) |
| InChIKey | LYESJJJAHGGYHG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|