C28H34N8 — CID 117088890
4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 117088890) has the molecular formula C28H34N8 and a molecular weight of 482.64 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117088890 |
| Molecular Formula | C28H34N8 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(Nc2ccc3ncccc3c2)nc(NC2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C28H34N8/c1-3-36(4-2)28-33-26(30-23-14-17-35(18-15-23)20-21-9-6-5-7-10-21)32-27(34-28)31-24-12-13-25-22(19-24)11-8-16-29-25/h5-13,16,19,23H,3-4,14-15,17-18,20H2,1-2H3,(H2,30,31,32,33,34) |
| InChIKey | SFCKGVDCZRFRSJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |