C27H34F3N7 — CID 117090153
4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117090153) has the molecular formula C27H34F3N7 and a molecular weight of 513.61 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117090153 |
| Molecular Formula | C27H34F3N7 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 4-N-(1-benzylpiperidin-4-yl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCc2cccc(C(F)(F)F)c2)nc(NC2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H34F3N7/c1-3-37(4-2)26-34-24(31-18-21-11-8-12-22(17-21)27(28,29)30)33-25(35-26)32-23-13-15-36(16-14-23)19-20-9-6-5-7-10-20/h5-12,17,23H,3-4,13-16,18-19H2,1-2H3,(H2,31,32,33,34,35) |
| InChIKey | JKNAZNGJRAXYEZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |