C20H18N4OS — CID 117091764
4-[2-[[2-amino-6-(1-benzothiophen-3-yl)pyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 117091764) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 4-[2-[[2-amino-6-(1-benzothiophen-3-yl)pyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-amino-6-(1-benzothiophen-3-yl)pyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117091764 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[2-[[2-amino-6-(1-benzothiophen-3-yl)pyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Nc1nc(NCCc2ccc(O)cc2)cc(-c2csc3ccccc23)n1 |
| InChI | InChI=1S/C20H18N4OS/c21-20-23-17(16-12-26-18-4-2-1-3-15(16)18)11-19(24-20)22-10-9-13-5-7-14(25)8-6-13/h1-8,11-12,25H,9-10H2,(H3,21,22,23,24) |
| InChIKey | BFDJRRSBNKILQZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |