C19H16N4 — CID 11709210
2,6-bis(4-methylphenyl)-7H-purine (PubChem CID 11709210) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 2,6-bis(4-methylphenyl)-7H-purine.
| Compound Name | 2,6-bis(4-methylphenyl)-7H-purine |
|---|---|
| PubChem CID | 11709210 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,6-bis(4-methylphenyl)-7H-purine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C19H16N4/c1-12-3-7-14(8-4-12)16-17-19(21-11-20-17)23-18(22-16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,20,21,22,23) |
| InChIKey | DEIRTPFLGXETKT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |