C22H28N4O — CID 117094210
N-[2-[di(propan-2-yl)amino]ethyl]-5-(1H-indol-5-yl)pyridine-3-carboxamide (PubChem CID 117094210) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-5-(1H-indol-5-yl)pyridine-3-carboxamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-(1H-indol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 117094210 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-(1H-indol-5-yl)pyridine-3-carboxamide |
| SMILES | CC(C)N(CCNC(=O)c1cncc(-c2ccc3[nH]ccc3c2)c1)C(C)C |
| InChI | InChI=1S/C22H28N4O/c1-15(2)26(16(3)4)10-9-25-22(27)20-12-19(13-23-14-20)17-5-6-21-18(11-17)7-8-24-21/h5-8,11-16,24H,9-10H2,1-4H3,(H,25,27) |
| InChIKey | RWNNBLJJJKORTQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |