C27H26N6O — CID 72545992
N-[3-(dimethylamino)propyl]-4-[7-(1H-indol-5-yl)pyrido[2,3-b]pyrazin-3-yl]benzamide (PubChem CID 72545992) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[7-(1H-indol-5-yl)pyrido[2,3-b]pyrazin-3-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[7-(1H-indol-5-yl)pyrido[2,3-b]pyrazin-3-yl]benzamide |
|---|---|
| PubChem CID | 72545992 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[7-(1H-indol-5-yl)pyrido[2,3-b]pyrazin-3-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cnc3cc(-c4ccc5[nH]ccc5c4)cnc3n2)cc1 |
| InChI | InChI=1S/C27H26N6O/c1-33(2)13-3-11-29-27(34)19-6-4-18(5-7-19)25-17-30-24-15-22(16-31-26(24)32-25)20-8-9-23-21(14-20)10-12-28-23/h4-10,12,14-17,28H,3,11,13H2,1-2H3,(H,29,34) |
| InChIKey | ISGWVXICMASBGG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|