C11H11F3N2O3 — CID 117096529
2-[3-(trifluoromethyl)pyrrolidin-3-yl]oxypyridine-3-carboxylic acid (PubChem CID 117096529) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)pyrrolidin-3-yl]oxypyridine-3-carboxylic acid.
| Compound Name | 2-[3-(trifluoromethyl)pyrrolidin-3-yl]oxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 117096529 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)pyrrolidin-3-yl]oxypyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1OC1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H11F3N2O3/c12-11(13,14)10(3-5-15-6-10)19-8-7(9(17)18)2-1-4-16-8/h1-2,4,15H,3,5-6H2,(H,17,18) |
| InChIKey | BXSGNGQMDFRNCE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |