C13H21N3O — CID 117096828
[2-(1,4-dimethylpiperidin-4-yl)oxy-3-pyridinyl]methanamine (PubChem CID 117096828) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [2-(1,4-dimethylpiperidin-4-yl)oxy-3-pyridinyl]methanamine.
| Compound Name | [2-(1,4-dimethylpiperidin-4-yl)oxy-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 117096828 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [2-(1,4-dimethylpiperidin-4-yl)oxy-3-pyridinyl]methanamine |
| SMILES | CN1CCC(C)(Oc2ncccc2CN)CC1 |
| InChI | InChI=1S/C13H21N3O/c1-13(5-8-16(2)9-6-13)17-12-11(10-14)4-3-7-15-12/h3-4,7H,5-6,8-10,14H2,1-2H3 |
| InChIKey | GUTRXRRPCUGFOW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |