C13H13N3O3 — CID 117099864
2-[[1-(cyanomethyl)-2-oxo-3H-indol-5-yl]-methylamino]acetic acid (PubChem CID 117099864) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[[1-(cyanomethyl)-2-oxo-3H-indol-5-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-(cyanomethyl)-2-oxo-3H-indol-5-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 117099864 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[[1-(cyanomethyl)-2-oxo-3H-indol-5-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)c1ccc2c(c1)CC(=O)N2CC#N |
| InChI | InChI=1S/C13H13N3O3/c1-15(8-13(18)19)10-2-3-11-9(6-10)7-12(17)16(11)5-4-14/h2-3,6H,5,7-8H2,1H3,(H,18,19) |
| InChIKey | QKMUPUWPCMUNSZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|