C16H20N2O3 — CID 117099651
2-[(1-but-3-enyl-2-oxo-3,4-dihydroquinolin-6-yl)-methylamino]acetic acid (PubChem CID 117099651) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(1-but-3-enyl-2-oxo-3,4-dihydroquinolin-6-yl)-methylamino]acetic acid.
| Compound Name | 2-[(1-but-3-enyl-2-oxo-3,4-dihydroquinolin-6-yl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 117099651 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(1-but-3-enyl-2-oxo-3,4-dihydroquinolin-6-yl)-methylamino]acetic acid |
| SMILES | C=CCCN1C(=O)CCc2cc(N(C)CC(=O)O)ccc21 |
| InChI | InChI=1S/C16H20N2O3/c1-3-4-9-18-14-7-6-13(17(2)11-16(20)21)10-12(14)5-8-15(18)19/h3,6-7,10H,1,4-5,8-9,11H2,2H3,(H,20,21) |
| InChIKey | XPJWZFOHMHPNBG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|