C15H17NO4 — CID 117100005
7-acetyl-5-(3-oxobutyl)-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 117100005) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 7-acetyl-5-(3-oxobutyl)-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 7-acetyl-5-(3-oxobutyl)-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 117100005 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 7-acetyl-5-(3-oxobutyl)-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CC(=O)CCN1C(=O)CCOc2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C15H17NO4/c1-10(17)5-7-16-13-9-12(11(2)18)3-4-14(13)20-8-6-15(16)19/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | KJWUKQRBAKIKJV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |