About 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine
3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine (PubChem CID 117100420) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine.
Analyze 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine?
The IUPAC name of 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine (CID 117100420) is 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine.
What is the SMILES notation for 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine?
The canonical SMILES for 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine is COc1cc2c(nn1)CNCC2.
What is the InChIKey of 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine?
The InChIKey is ZLGRJTBMAVZEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-12-8-4-6-2-3-9-5-7(6)10-11-8/h4,9H,2-3,5H2,1H3.
What are the key properties of 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine?
3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine has a molecular weight of 165.20 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine is sourced from PubChem (CID 117100420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).