C14H16N4 — CID 117101711
N-benzyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 117101711) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-benzyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-benzyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 117101711 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-benzyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | c1ccc(CNc2ncnc3c2CCNC3)cc1 |
| InChI | InChI=1S/C14H16N4/c1-2-4-11(5-3-1)8-16-14-12-6-7-15-9-13(12)17-10-18-14/h1-5,10,15H,6-9H2,(H,16,17,18) |
| InChIKey | NBEFGNPITCSXSD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |