C15H16N4O — CID 117101715
4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 117101715) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 117101715 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | c1ccc2c(c1)OCCN2c1ncnc2c1CCNC2 |
| InChI | InChI=1S/C15H16N4O/c1-2-4-14-13(3-1)19(7-8-20-14)15-11-5-6-16-9-12(11)17-10-18-15/h1-4,10,16H,5-9H2 |
| InChIKey | JGWOMQVDMYDMDB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |