C22H42O2Si — CID 11710370
[(5R)-5-[(3R)-hexa-1,5-dien-3-yl]oxyhept-6-enoxy]-tri(propan-2-yl)silane (PubChem CID 11710370) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is [(5R)-5-[(3R)-hexa-1,5-dien-3-yl]oxyhept-6-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(5R)-5-[(3R)-hexa-1,5-dien-3-yl]oxyhept-6-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11710370 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | [(5R)-5-[(3R)-hexa-1,5-dien-3-yl]oxyhept-6-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=CC[C@H](C=C)O[C@@H](C=C)CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O2Si/c1-10-15-21(11-2)24-22(12-3)16-13-14-17-23-25(18(4)5,19(6)7)20(8)9/h10-12,18-22H,1-3,13-17H2,4-9H3/t21-,22-/m0/s1 |
| InChIKey | OZGAEFPTHPUTFZ-VXKWHMMOSA-N |
| XLogP | 7.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|