C16H36O2Si2 — CID 10734226
dimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]-trimethylsilyloxysilane (PubChem CID 10734226) has the molecular formula C16H36O2Si2 and a molecular weight of 316.63 g/mol. Its IUPAC name is dimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]-trimethylsilyloxysilane.
| Compound Name | dimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 10734226 |
| Molecular Formula | C16H36O2Si2 |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | dimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]-trimethylsilyloxysilane |
| SMILES | C=CC[C@H](C)O[C@H](CCCCC)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O2Si2/c1-9-11-12-14-16(17-15(3)13-10-2)20(7,8)18-19(4,5)6/h10,15-16H,2,9,11-14H2,1,3-8H3/t15-,16-/m0/s1 |
| InChIKey | PBKSJMJLYMXNED-HOTGVXAUSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|