C15H32O2Si2 — CID 14106275
trimethyl-[(1R,3S)-1-prop-2-enyl-3-trimethylsilyloxyhex-5-enoxy]silane (PubChem CID 14106275) has the molecular formula C15H32O2Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is trimethyl-[(1R,3S)-1-prop-2-enyl-3-trimethylsilyloxyhex-5-enoxy]silane.
| Compound Name | trimethyl-[(1R,3S)-1-prop-2-enyl-3-trimethylsilyloxyhex-5-enoxy]silane |
|---|---|
| PubChem CID | 14106275 |
| Molecular Formula | C15H32O2Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | trimethyl-[(1R,3S)-1-prop-2-enyl-3-trimethylsilyloxyhex-5-enoxy]silane |
| SMILES | C=CC[C@H](C[C@H](CC=C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O2Si2/c1-9-11-14(16-18(3,4)5)13-15(12-10-2)17-19(6,7)8/h9-10,14-15H,1-2,11-13H2,3-8H3/t14-,15+ |
| InChIKey | BQPYEVLCNWIMBO-GASCZTMLSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|